C22H22N4O — CID 7326946
3-phenyl-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 7326946) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-phenyl-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7326946 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-phenyl-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccccc2)n[nH]1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H22N4O/c1-15(18-12-11-16-7-5-6-10-19(16)13-18)23-26-22(27)21-14-20(24-25-21)17-8-3-2-4-9-17/h2-4,8-9,11-14H,5-7,10H2,1H3,(H,24,25)(H,26,27)/b23-15- |
| InChIKey | IVULFVZIWYXDBU-HAHDFKILSA-N |
| XLogP | 4.11 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|