C22H17FN4O — CID 1185508
3-(4-fluorophenyl)-N-(1-naphthalen-2-ylethylideneamino)-1H-pyrazole-5-carboxamide (PubChem CID 1185508) has the molecular formula C22H17FN4O and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(1-naphthalen-2-ylethylideneamino)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(1-naphthalen-2-ylethylideneamino)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 1185508 |
| Molecular Formula | C22H17FN4O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(1-naphthalen-2-ylethylideneamino)-1H-pyrazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(F)cc2)n[nH]1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17FN4O/c1-14(17-7-6-15-4-2-3-5-18(15)12-17)24-27-22(28)21-13-20(25-26-21)16-8-10-19(23)11-9-16/h2-13H,1H3,(H,25,26)(H,27,28) |
| InChIKey | KXFQDJUSLHYBIZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|