C21H16BrN5O6 — CID 126352231
2-(4-bromoanilino)-N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide (PubChem CID 126352231) has the molecular formula C21H16BrN5O6 and a molecular weight of 514.29 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126352231 |
| Molecular Formula | C21H16BrN5O6 |
| Molecular Weight | 514.29 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Br)cc1)N/N=C\c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16BrN5O6/c22-15-3-5-16(6-4-15)23-13-21(28)25-24-12-14-1-8-18(9-2-14)33-20-10-7-17(26(29)30)11-19(20)27(31)32/h1-12,23H,13H2,(H,25,28)/b24-12- |
| InChIKey | KAVYPNFVVBSYCA-MSXFZWOLSA-N |
| XLogP | 4.62 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|