C24H13BrN2O8 — CID 3255248
[4-bromo-2-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 3255248) has the molecular formula C24H13BrN2O8 and a molecular weight of 537.28 g/mol. Its IUPAC name is [4-bromo-2-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-bromo-2-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 3255248 |
| Molecular Formula | C24H13BrN2O8 |
| Molecular Weight | 537.28 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | [4-bromo-2-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C1OC(c2ccc([N+](=O)[O-])cc2)=NC1=Cc1cc(Br)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H13BrN2O8/c25-16-4-8-19(34-23(28)14-3-7-20-21(11-14)33-12-32-20)15(9-16)10-18-24(29)35-22(26-18)13-1-5-17(6-2-13)27(30)31/h1-11H,12H2 |
| InChIKey | QUIVVEQZUWQKBT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|