C22H20N2O6 — CID 9313335
2-[4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-methylanilino]ethyl acetate (PubChem CID 9313335) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-methylanilino]ethyl acetate.
| Compound Name | 2-[4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-methylanilino]ethyl acetate |
|---|---|
| PubChem CID | 9313335 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-methylanilino]ethyl acetate |
| SMILES | CC(=O)OCCN(C)c1ccc(/C=C2\N=C(c3ccc4c(c3)OCO4)OC2=O)cc1 |
| InChI | InChI=1S/C22H20N2O6/c1-14(25)27-10-9-24(2)17-6-3-15(4-7-17)11-18-22(26)30-21(23-18)16-5-8-19-20(12-16)29-13-28-19/h3-8,11-12H,9-10,13H2,1-2H3/b18-11- |
| InChIKey | HFSFVSXOLHQMKC-WQRHYEAKSA-N |
| XLogP | 2.76 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|