C21H9Br2Cl2NO5 — CID 126201711
[2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126201711) has the molecular formula C21H9Br2Cl2NO5 and a molecular weight of 586.02 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126201711 |
| Molecular Formula | C21H9Br2Cl2NO5 |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 582.82 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1cc(Br)cc(Br)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H9Br2Cl2NO5/c22-11-6-10(18(14(23)8-11)30-21(28)17-2-1-5-29-17)7-16-20(27)31-19(26-16)13-4-3-12(24)9-15(13)25/h1-9H/b16-7- |
| InChIKey | VOVVBPZOJNNQHJ-APSNUPSMSA-N |
| XLogP | 6.68 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|