C26H18ClNO5 — CID 126198523
[2-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126198523) has the molecular formula C26H18ClNO5 and a molecular weight of 459.89 g/mol. Its IUPAC name is [2-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126198523 |
| Molecular Formula | C26H18ClNO5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [2-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1ccc(Cl)cc1C1=N/C(=C\c2ccccc2OC(=O)/C=C/c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C26H18ClNO5/c1-31-23-13-12-19(27)16-20(23)25-28-21(26(30)33-25)15-18-9-5-6-10-22(18)32-24(29)14-11-17-7-3-2-4-8-17/h2-16H,1H3/b14-11+,21-15- |
| InChIKey | WGVAQXPUQBOEFB-DRXPRRSGSA-N |
| XLogP | 5.31 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|