C25H17NO4 — CID 2896516
[2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 2896516) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2896516 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)Oc1ccccc1C=C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C25H17NO4/c27-23(16-15-18-9-3-1-4-10-18)29-22-14-8-7-13-20(22)17-21-25(28)30-24(26-21)19-11-5-2-6-12-19/h1-17H |
| InChIKey | ASBTWVWYGUYDQS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|