C15H16N2O6 — CID 2913352
2-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]propanoic acid (PubChem CID 2913352) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 2913352 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[4-[(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(C=C2NC(=O)NC2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C15H16N2O6/c1-3-22-12-7-9(6-10-13(18)17-15(21)16-10)4-5-11(12)23-8(2)14(19)20/h4-8H,3H2,1-2H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | ZYQZMIDWCRJPME-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|