C13H12N2O5 — CID 963234
(2S)-2-[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 963234) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 963234 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (2S)-2-[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1ccc(/C=C2/NC(=O)NC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H12N2O5/c1-7(12(17)18)20-9-4-2-8(3-5-9)6-10-11(16)15-13(19)14-10/h2-7H,1H3,(H,17,18)(H2,14,15,16,19)/b10-6+/t7-/m0/s1 |
| InChIKey | OWTWMCDGDJMLEM-FSEMZKDTSA-N |
| XLogP | 0.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|