C30H28O4 — CID 11775336
(E)-3-[3,4,5-tris(phenylmethoxy)phenyl]prop-2-en-1-ol (PubChem CID 11775336) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is (E)-3-[3,4,5-tris(phenylmethoxy)phenyl]prop-2-en-1-ol.
| Compound Name | (E)-3-[3,4,5-tris(phenylmethoxy)phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11775336 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (E)-3-[3,4,5-tris(phenylmethoxy)phenyl]prop-2-en-1-ol |
| SMILES | OC/C=C/c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H28O4/c31-18-10-17-27-19-28(32-21-24-11-4-1-5-12-24)30(34-23-26-15-8-3-9-16-26)29(20-27)33-22-25-13-6-2-7-14-25/h1-17,19-20,31H,18,21-23H2/b17-10+ |
| InChIKey | UDEKJVIAGVARMK-LICLKQGHSA-N |
| XLogP | 6.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |