C14H21Br2NO3 — CID 107741471
1-[4-(aminomethyl)-2,6-dibromophenoxy]-3-butoxypropan-2-ol (PubChem CID 107741471) has the molecular formula C14H21Br2NO3 and a molecular weight of 411.13 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2,6-dibromophenoxy]-3-butoxypropan-2-ol.
| Compound Name | 1-[4-(aminomethyl)-2,6-dibromophenoxy]-3-butoxypropan-2-ol |
|---|---|
| PubChem CID | 107741471 |
| Molecular Formula | C14H21Br2NO3 |
| Molecular Weight | 411.13 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 1-[4-(aminomethyl)-2,6-dibromophenoxy]-3-butoxypropan-2-ol |
| SMILES | CCCCOCC(O)COc1c(Br)cc(CN)cc1Br |
| InChI | InChI=1S/C14H21Br2NO3/c1-2-3-4-19-8-11(18)9-20-14-12(15)5-10(7-17)6-13(14)16/h5-6,11,18H,2-4,7-9,17H2,1H3 |
| InChIKey | XKKOELIGZOAHAX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|