C17H25ClF3NO2 — CID 87598388
2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde;hydrochloride (PubChem CID 87598388) has the molecular formula C17H25ClF3NO2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde;hydrochloride.
| Compound Name | 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde;hydrochloride |
|---|---|
| PubChem CID | 87598388 |
| Molecular Formula | C17H25ClF3NO2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde;hydrochloride |
| SMILES | CCCCCCCCOc1ccc(C(N)C=O)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C17H24F3NO2.ClH/c1-2-3-4-5-6-7-10-23-16-9-8-13(15(21)12-22)11-14(16)17(18,19)20;/h8-9,11-12,15H,2-7,10,21H2,1H3;1H |
| InChIKey | IPKVGMIQKXMMRO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|