C12H17F2N — CID 21355559
N-[(3,5-difluorophenyl)methyl]-3-methylbutan-1-amine (PubChem CID 21355559) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-3-methylbutan-1-amine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 21355559 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-3-methylbutan-1-amine |
| SMILES | CC(C)CCNCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-9(2)3-4-15-8-10-5-11(13)7-12(14)6-10/h5-7,9,15H,3-4,8H2,1-2H3 |
| InChIKey | JLKIUQAOTAGMHU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|