C12H16BrF2N — CID 105409104
3-bromo-N-[(3,5-difluorophenyl)methyl]pentan-1-amine (PubChem CID 105409104) has the molecular formula C12H16BrF2N and a molecular weight of 292.17 g/mol. Its IUPAC name is 3-bromo-N-[(3,5-difluorophenyl)methyl]pentan-1-amine.
| Compound Name | 3-bromo-N-[(3,5-difluorophenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 105409104 |
| Molecular Formula | C12H16BrF2N |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-bromo-N-[(3,5-difluorophenyl)methyl]pentan-1-amine |
| SMILES | CCC(Br)CCNCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16BrF2N/c1-2-10(13)3-4-16-8-9-5-11(14)7-12(15)6-9/h5-7,10,16H,2-4,8H2,1H3 |
| InChIKey | XKLNMYABAIBKQG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|