C19H24F2N2 — CID 69324163
(3S)-4-(3,5-difluorophenyl)-1-N-[(3-ethylphenyl)methyl]butane-1,3-diamine (PubChem CID 69324163) has the molecular formula C19H24F2N2 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3S)-4-(3,5-difluorophenyl)-1-N-[(3-ethylphenyl)methyl]butane-1,3-diamine.
| Compound Name | (3S)-4-(3,5-difluorophenyl)-1-N-[(3-ethylphenyl)methyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 69324163 |
| Molecular Formula | C19H24F2N2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3S)-4-(3,5-difluorophenyl)-1-N-[(3-ethylphenyl)methyl]butane-1,3-diamine |
| SMILES | CCc1cccc(CNCC[C@@H](N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C19H24F2N2/c1-2-14-4-3-5-15(8-14)13-23-7-6-19(22)11-16-9-17(20)12-18(21)10-16/h3-5,8-10,12,19,23H,2,6-7,11,13,22H2,1H3/t19-/m1/s1 |
| InChIKey | UREBRAYRIFMHLM-LJQANCHMSA-N |
| XLogP | 3.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|