C18H21F3N2O — CID 91391808
(3S)-4-phenyl-1-N-[[3-(trifluoromethoxy)phenyl]methyl]butane-1,3-diamine (PubChem CID 91391808) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is (3S)-4-phenyl-1-N-[[3-(trifluoromethoxy)phenyl]methyl]butane-1,3-diamine.
| Compound Name | (3S)-4-phenyl-1-N-[[3-(trifluoromethoxy)phenyl]methyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 91391808 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3S)-4-phenyl-1-N-[[3-(trifluoromethoxy)phenyl]methyl]butane-1,3-diamine |
| SMILES | N[C@H](CCNCc1cccc(OC(F)(F)F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C18H21F3N2O/c19-18(20,21)24-17-8-4-7-15(12-17)13-23-10-9-16(22)11-14-5-2-1-3-6-14/h1-8,12,16,23H,9-11,13,22H2/t16-/m1/s1 |
| InChIKey | XXEJCWZHKWKPHH-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|