C10H13F3N2O3S — CID 107104428
2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanesulfonamide (PubChem CID 107104428) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 107104428 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H13F3N2O3S/c11-10(12,13)18-9-3-1-2-8(6-9)7-15-4-5-19(14,16)17/h1-3,6,15H,4-5,7H2,(H2,14,16,17) |
| InChIKey | UPUZDDNQPGXWMV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|