C27H32F2N6O — CID 142241831
N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[(2-methylhydrazinyl)diazenyl]benzamide (PubChem CID 142241831) has the molecular formula C27H32F2N6O and a molecular weight of 494.59 g/mol. Its IUPAC name is N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[(2-methylhydrazinyl)diazenyl]benzamide.
| Compound Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[(2-methylhydrazinyl)diazenyl]benzamide |
|---|---|
| PubChem CID | 142241831 |
| Molecular Formula | C27H32F2N6O |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[(2-methylhydrazinyl)diazenyl]benzamide |
| SMILES | CCc1cccc(CNCC[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2ccc(/N=N/NNC)cc2)c1 |
| InChI | InChI=1S/C27H32F2N6O/c1-3-19-5-4-6-20(13-19)18-31-12-11-26(16-21-14-23(28)17-24(29)15-21)32-27(36)22-7-9-25(10-8-22)33-35-34-30-2/h4-10,13-15,17,26,31H,3,11-12,16,18H2,1-2H3,(H,30,35)(H,32,36)(H,33,34)/t26-/m1/s1 |
| InChIKey | MYWRPTHXYPWWNL-AREMUKBSSA-N |
| XLogP | 4.77 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|