C33H39F2N3O — CID 142242820
1-butyl-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methylindole-6-carboxamide (PubChem CID 142242820) has the molecular formula C33H39F2N3O and a molecular weight of 531.69 g/mol. Its IUPAC name is 1-butyl-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methylindole-6-carboxamide.
| Compound Name | 1-butyl-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methylindole-6-carboxamide |
|---|---|
| PubChem CID | 142242820 |
| Molecular Formula | C33H39F2N3O |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 1-butyl-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methylindole-6-carboxamide |
| SMILES | CCCCn1ccc2c(C)cc(C(=O)N[C@H](CCNCc3cccc(CC)c3)Cc3cc(F)cc(F)c3)cc21 |
| InChI | InChI=1S/C33H39F2N3O/c1-4-6-13-38-14-11-31-23(3)15-27(20-32(31)38)33(39)37-30(19-26-17-28(34)21-29(35)18-26)10-12-36-22-25-9-7-8-24(5-2)16-25/h7-9,11,14-18,20-21,30,36H,4-6,10,12-13,19,22H2,1-3H3,(H,37,39)/t30-/m1/s1 |
| InChIKey | NXPUQEGTMULNTL-SSEXGKCCSA-N |
| XLogP | 7.11 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|