C32H41F2N3O3S — CID 142242789
N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[methyl(3-methylbutyl)sulfamoyl]benzamide (PubChem CID 142242789) has the molecular formula C32H41F2N3O3S and a molecular weight of 585.76 g/mol. Its IUPAC name is N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[methyl(3-methylbutyl)sulfamoyl]benzamide.
| Compound Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[methyl(3-methylbutyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 142242789 |
| Molecular Formula | C32H41F2N3O3S |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-[methyl(3-methylbutyl)sulfamoyl]benzamide |
| SMILES | CCc1cccc(CNCC[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2ccc(S(=O)(=O)N(C)CCC(C)C)cc2)c1 |
| InChI | InChI=1S/C32H41F2N3O3S/c1-5-24-7-6-8-25(17-24)22-35-15-13-30(20-26-18-28(33)21-29(34)19-26)36-32(38)27-9-11-31(12-10-27)41(39,40)37(4)16-14-23(2)3/h6-12,17-19,21,23,30,35H,5,13-16,20,22H2,1-4H3,(H,36,38)/t30-/m1/s1 |
| InChIKey | AEMBAPJCEHVBNU-SSEXGKCCSA-N |
| XLogP | 5.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|