C24H27F2N3O2 — CID 142242320
N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 142242320) has the molecular formula C24H27F2N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 142242320 |
| Molecular Formula | C24H27F2N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CCc1cccc(CNCC[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2ocnc2C)c1 |
| InChI | InChI=1S/C24H27F2N3O2/c1-3-17-5-4-6-18(9-17)14-27-8-7-22(12-19-10-20(25)13-21(26)11-19)29-24(30)23-16(2)28-15-31-23/h4-6,9-11,13,15,22,27H,3,7-8,12,14H2,1-2H3,(H,29,30)/t22-/m1/s1 |
| InChIKey | NUDSDYPOZJZJSU-JOCHJYFZSA-N |
| XLogP | 4.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|