C26H28ClF2N3O — CID 142241804
2-chloro-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-6-methylpyridine-4-carboxamide (PubChem CID 142241804) has the molecular formula C26H28ClF2N3O and a molecular weight of 471.98 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-6-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 142241804 |
| Molecular Formula | C26H28ClF2N3O |
| Molecular Weight | 471.98 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-chloro-N-[(2S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]butan-2-yl]-6-methylpyridine-4-carboxamide |
| SMILES | CCc1cccc(CNCC[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(C)nc(Cl)c2)c1 |
| InChI | InChI=1S/C26H28ClF2N3O/c1-3-18-5-4-6-19(10-18)16-30-8-7-24(13-20-11-22(28)15-23(29)12-20)32-26(33)21-9-17(2)31-25(27)14-21/h4-6,9-12,14-15,24,30H,3,7-8,13,16H2,1-2H3,(H,32,33)/t24-/m1/s1 |
| InChIKey | CSTTVJQQMUWRMA-XMMPIXPASA-N |
| XLogP | 5.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|