C33H42F2N4O3 — CID 21085290
4-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methyl-2-N,2-N-dipropylpyridine-2,4-dicarboxamide (PubChem CID 21085290) has the molecular formula C33H42F2N4O3 and a molecular weight of 580.72 g/mol. Its IUPAC name is 4-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methyl-2-N,2-N-dipropylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methyl-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 21085290 |
| Molecular Formula | C33H42F2N4O3 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 4-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-6-methyl-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(CC)c2)cc(C)n1 |
| InChI | InChI=1S/C33H42F2N4O3/c1-5-11-39(12-6-2)33(42)30-18-26(13-22(4)37-30)32(41)38-29(17-25-15-27(34)19-28(35)16-25)31(40)21-36-20-24-10-8-9-23(7-3)14-24/h8-10,13-16,18-19,29,31,36,40H,5-7,11-12,17,20-21H2,1-4H3,(H,38,41)/t29-,31+/m0/s1 |
| InChIKey | MATVLQJGKSTSJG-IGYGKHONSA-N |
| XLogP | 4.98 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |