C39H54F2N4O3 — CID 58802670
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[4-(dimethylamino)butyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58802670) has the molecular formula C39H54F2N4O3 and a molecular weight of 664.88 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[4-(dimethylamino)butyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[4-(dimethylamino)butyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58802670 |
| Molecular Formula | C39H54F2N4O3 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[4-(dimethylamino)butyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(CCCCN(C)C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C39H54F2N4O3/c1-6-15-45(16-7-2)39(48)33-20-29(12-9-10-17-44(4)5)19-32(24-33)38(47)43-36(23-31-21-34(40)25-35(41)22-31)37(46)27-42-26-30-14-11-13-28(8-3)18-30/h11,13-14,18-22,24-25,36-37,42,46H,6-10,12,15-17,23,26-27H2,1-5H3,(H,43,47)/t36-,37+/m0/s1 |
| InChIKey | SIFBUZVKSDYBGP-PQQNNWGCSA-N |
| XLogP | 6.17 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|