C37H46F2N4O3 — CID 58802904
1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[3-(methylamino)prop-1-ynyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58802904) has the molecular formula C37H46F2N4O3 and a molecular weight of 632.80 g/mol. Its IUPAC name is 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[3-(methylamino)prop-1-ynyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[3-(methylamino)prop-1-ynyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58802904 |
| Molecular Formula | C37H46F2N4O3 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-[3-(methylamino)prop-1-ynyl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C#CCNC)cc(C(=O)N[C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C37H46F2N4O3/c1-5-14-43(15-6-2)37(46)31-18-27(12-9-13-40-4)17-30(22-31)36(45)42-34(21-29-19-32(38)23-33(39)20-29)35(44)25-41-24-28-11-8-10-26(7-3)16-28/h8,10-11,16-20,22-23,34-35,40-41,44H,5-7,13-15,21,24-25H2,1-4H3,(H,42,45)/t34-,35+/m1/s1 |
| InChIKey | IKNGDOCAWBLZAP-GPOMZPHUSA-N |
| XLogP | 4.85 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|