C39H46F2N4O5S — CID 68608912
5-(benzenesulfonamido)-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68608912) has the molecular formula C39H46F2N4O5S and a molecular weight of 720.88 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-(benzenesulfonamido)-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68608912 |
| Molecular Formula | C39H46F2N4O5S |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | 5-(benzenesulfonamido)-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NS(=O)(=O)c2ccccc2)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C39H46F2N4O5S/c1-4-15-45(16-5-2)39(48)31-21-30(22-34(23-31)44-51(49,50)35-13-8-7-9-14-35)38(47)43-36(20-29-18-32(40)24-33(41)19-29)37(46)26-42-25-28-12-10-11-27(6-3)17-28/h7-14,17-19,21-24,36-37,42,44,46H,4-6,15-16,20,25-26H2,1-3H3,(H,43,47)/t36-,37+/m0/s1 |
| InChIKey | JWPXQULEBFKRGN-PQQNNWGCSA-N |
| XLogP | 6.08 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |