C36H43F2N5O4 — CID 58802492
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(5-methyl-1,2,4-oxadiazol-3-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58802492) has the molecular formula C36H43F2N5O4 and a molecular weight of 647.77 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(5-methyl-1,2,4-oxadiazol-3-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(5-methyl-1,2,4-oxadiazol-3-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58802492 |
| Molecular Formula | C36H43F2N5O4 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.33 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(5-methyl-1,2,4-oxadiazol-3-yl)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(CC)c2)cc(-c2noc(C)n2)c1 |
| InChI | InChI=1S/C36H43F2N5O4/c1-5-11-43(12-6-2)36(46)29-18-27(34-40-23(4)47-42-34)17-28(19-29)35(45)41-32(16-26-14-30(37)20-31(38)15-26)33(44)22-39-21-25-10-8-9-24(7-3)13-25/h8-10,13-15,17-20,32-33,39,44H,5-7,11-12,16,21-22H2,1-4H3,(H,41,45)/t32-,33+/m0/s1 |
| InChIKey | PLMQSZYDYDJKNL-JHOUSYSJSA-N |
| XLogP | 5.64 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |