C30H38Cl2F2IN3O — CID 142673323
N-[1-(3,5-difluorophenyl)-4-[(3-iodophenyl)methylamino]butan-2-yl]-3-methyl-5-[[methyl(propyl)amino]methyl]benzamide;dihydrochloride (PubChem CID 142673323) has the molecular formula C30H38Cl2F2IN3O and a molecular weight of 692.46 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-4-[(3-iodophenyl)methylamino]butan-2-yl]-3-methyl-5-[[methyl(propyl)amino]methyl]benzamide;dihydrochloride.
| Compound Name | N-[1-(3,5-difluorophenyl)-4-[(3-iodophenyl)methylamino]butan-2-yl]-3-methyl-5-[[methyl(propyl)amino]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 142673323 |
| Molecular Formula | C30H38Cl2F2IN3O |
| Molecular Weight | 692.46 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-4-[(3-iodophenyl)methylamino]butan-2-yl]-3-methyl-5-[[methyl(propyl)amino]methyl]benzamide;dihydrochloride |
| SMILES | CCCN(C)Cc1cc(C)cc(C(=O)NC(CCNCc2cccc(I)c2)Cc2cc(F)cc(F)c2)c1.Cl.Cl |
| InChI | InChI=1S/C30H36F2IN3O.2ClH/c1-4-10-36(3)20-24-11-21(2)12-25(13-24)30(37)35-29(17-23-14-26(31)18-27(32)15-23)8-9-34-19-22-6-5-7-28(33)16-22;;/h5-7,11-16,18,29,34H,4,8-10,17,19-20H2,1-3H3,(H,35,37);2*1H |
| InChIKey | JUXPRLGGUIATJP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|