C30H36F3N3O3 — CID 142242439
N-[1-(3,5-difluorophenyl)-4-[(3-methylphenyl)methylamino]butan-2-yl]-3-fluoro-4-morpholin-4-ylbenzamide;methanol (PubChem CID 142242439) has the molecular formula C30H36F3N3O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-4-[(3-methylphenyl)methylamino]butan-2-yl]-3-fluoro-4-morpholin-4-ylbenzamide;methanol.
| Compound Name | N-[1-(3,5-difluorophenyl)-4-[(3-methylphenyl)methylamino]butan-2-yl]-3-fluoro-4-morpholin-4-ylbenzamide;methanol |
|---|---|
| PubChem CID | 142242439 |
| Molecular Formula | C30H36F3N3O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-4-[(3-methylphenyl)methylamino]butan-2-yl]-3-fluoro-4-morpholin-4-ylbenzamide;methanol |
| SMILES | CO.Cc1cccc(CNCCC(Cc2cc(F)cc(F)c2)NC(=O)c2ccc(N3CCOCC3)c(F)c2)c1 |
| InChI | InChI=1S/C29H32F3N3O2.CH4O/c1-20-3-2-4-21(13-20)19-33-8-7-26(16-22-14-24(30)18-25(31)15-22)34-29(36)23-5-6-28(27(32)17-23)35-9-11-37-12-10-35;1-2/h2-6,13-15,17-18,26,33H,7-12,16,19H2,1H3,(H,34,36);2H,1H3 |
| InChIKey | BDHIWGQMOCWESO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|