C19H16Cl3NO — CID 17209837
N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 17209837) has the molecular formula C19H16Cl3NO and a molecular weight of 380.70 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 17209837 |
| Molecular Formula | C19H16Cl3NO |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | Clc1cccc(-c2ccc(CNCCc3ccc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C19H16Cl3NO/c20-15-3-1-2-14(10-15)19-7-6-17(24-19)12-23-9-8-13-4-5-16(21)11-18(13)22/h1-7,10-11,23H,8-9,12H2 |
| InChIKey | CXGDZXOOHIDSMM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|