C13H11ClO3 — CID 82119349
2-[5-(3-chloro-2-methylphenyl)furan-2-yl]acetic acid (PubChem CID 82119349) has the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. Its IUPAC name is 2-[5-(3-chloro-2-methylphenyl)furan-2-yl]acetic acid.
| Compound Name | 2-[5-(3-chloro-2-methylphenyl)furan-2-yl]acetic acid |
|---|---|
| PubChem CID | 82119349 |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-[5-(3-chloro-2-methylphenyl)furan-2-yl]acetic acid |
| SMILES | Cc1c(Cl)cccc1-c1ccc(CC(=O)O)o1 |
| InChI | InChI=1S/C13H11ClO3/c1-8-10(3-2-4-11(8)14)12-6-5-9(17-12)7-13(15)16/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | APCFZYYEXWFGPE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |