C19H23Cl2NO — CID 134232523
N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-3-ethylhex-5-en-1-amine (PubChem CID 134232523) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-3-ethylhex-5-en-1-amine.
| Compound Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-3-ethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 134232523 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-3-ethylhex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C19H23Cl2NO/c1-3-5-14(4-2)10-11-22-13-16-7-9-19(23-16)17-8-6-15(20)12-18(17)21/h3,6-9,12,14,22H,1,4-5,10-11,13H2,2H3 |
| InChIKey | CVMLFHICTPZZFU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|