C19H22ClFN2O2 — CID 110211426
(3R,7R)-2-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 110211426) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is (3R,7R)-2-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R)-2-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 110211426 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (3R,7R)-2-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C[C@@H]1CN2C[C@H](O)CC2CN1Cc1ccc(-c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H22ClFN2O2/c1-12-8-23-10-15(24)7-14(23)9-22(12)11-16-3-5-19(25-16)13-2-4-18(21)17(20)6-13/h2-6,12,14-15,24H,7-11H2,1H3/t12-,14?,15-/m1/s1 |
| InChIKey | ZIENODVQWPXTOT-SULGFLJSSA-N |
| XLogP | 3.38 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |