C19H23ClN2O2 — CID 92604080
(3S,7R,8aR)-2-[[5-(2-chlorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 92604080) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is (3S,7R,8aR)-2-[[5-(2-chlorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7R,8aR)-2-[[5-(2-chlorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 92604080 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S,7R,8aR)-2-[[5-(2-chlorophenyl)furan-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C[C@H]1CN2C[C@H](O)C[C@@H]2CN1Cc1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-13-9-22-11-15(23)8-14(22)10-21(13)12-16-6-7-19(24-16)17-4-2-3-5-18(17)20/h2-7,13-15,23H,8-12H2,1H3/t13-,14+,15+/m0/s1 |
| InChIKey | XNIGATOWDBZRCB-RRFJBIMHSA-N |
| XLogP | 3.24 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |