C14H17N5OS — CID 154349442
1-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]-3,4-dihydroquinolin-2-one (PubChem CID 154349442) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 154349442 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]-3,4-dihydroquinolin-2-one |
| SMILES | Cn1nnnc1SCCCN1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C14H17N5OS/c1-18-14(15-16-17-18)21-10-4-9-19-12-6-3-2-5-11(12)7-8-13(19)20/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | GDLVFFIVNSNLAQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|