C21H26FN5O2S — CID 17212634
N-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17212634) has the molecular formula C21H26FN5O2S and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17212634 |
| Molecular Formula | C21H26FN5O2S |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | CCOc1cccc(CNCCCSc2nnnn2C)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H26FN5O2S/c1-3-28-19-11-6-9-16(20(19)29-15-17-8-4-5-10-18(17)22)14-23-12-7-13-30-21-24-25-26-27(21)2/h4-6,8-11,23H,3,7,12-15H2,1-2H3 |
| InChIKey | LSLOQXQWTIYMPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|