C26H27ClN4 — CID 124824014
(1R)-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylbutan-1-amine (PubChem CID 124824014) has the molecular formula C26H27ClN4 and a molecular weight of 430.98 g/mol. Its IUPAC name is (1R)-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylbutan-1-amine.
| Compound Name | (1R)-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 124824014 |
| Molecular Formula | C26H27ClN4 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (1R)-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylbutan-1-amine |
| SMILES | CCC[C@@H](NCc1nn(Cc2cccc(Cl)c2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27ClN4/c1-2-10-24(21-12-5-3-6-13-21)28-18-25-26(22-14-7-4-8-15-22)30-31(29-25)19-20-11-9-16-23(27)17-20/h3-9,11-17,24,28H,2,10,18-19H2,1H3/t24-/m1/s1 |
| InChIKey | NAVNLUSMSOTQPU-XMMPIXPASA-N |
| XLogP | 6.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |