C18H19ClN4 — CID 124806285
2-(4-chlorophenyl)-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]ethanamine (PubChem CID 124806285) has the molecular formula C18H19ClN4 and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 124806285 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]ethanamine |
| SMILES | Cn1nc(CNCCc2ccc(Cl)cc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H19ClN4/c1-23-21-17(18(22-23)15-5-3-2-4-6-15)13-20-12-11-14-7-9-16(19)10-8-14/h2-10,20H,11-13H2,1H3 |
| InChIKey | ABKYUMSHULUMIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|