C20H24N4 — CID 124810142
2-phenyl-N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]ethanamine (PubChem CID 124810142) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-phenyl-N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-phenyl-N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 124810142 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-phenyl-N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]ethanamine |
| SMILES | CC(C)n1nc(CNCCc2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H24N4/c1-16(2)24-22-19(20(23-24)18-11-7-4-8-12-18)15-21-14-13-17-9-5-3-6-10-17/h3-12,16,21H,13-15H2,1-2H3 |
| InChIKey | ZBQASHOKCHQDSA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|