C15H23ClN4 — CID 133108212
N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]propan-1-amine;hydrochloride (PubChem CID 133108212) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 133108212 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[(5-phenyl-2-propan-2-yltriazol-4-yl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1nn(C(C)C)nc1-c1ccccc1.Cl |
| InChI | InChI=1S/C15H22N4.ClH/c1-4-10-16-11-14-15(13-8-6-5-7-9-13)18-19(17-14)12(2)3;/h5-9,12,16H,4,10-11H2,1-3H3;1H |
| InChIKey | WSKSOKPMGMLPSU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|