C17H27N5 — CID 125114554
N',N'-diethyl-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 125114554) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is N',N'-diethyl-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 125114554 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | N',N'-diethyl-N-[(2-methyl-5-phenyltriazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1nn(C)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H27N5/c1-4-22(5-2)13-9-12-18-14-16-17(20-21(3)19-16)15-10-7-6-8-11-15/h6-8,10-11,18H,4-5,9,12-14H2,1-3H3 |
| InChIKey | PAWAOLHSCHGILI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|