C12H17F2NOS2 — CID 107295296
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107295296) has the molecular formula C12H17F2NOS2 and a molecular weight of 293.40 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107295296 |
| Molecular Formula | C12H17F2NOS2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | FC(F)SCc1ccc(CNCC2CCSC2)o1 |
| InChI | InChI=1S/C12H17F2NOS2/c13-12(14)18-8-11-2-1-10(16-11)6-15-5-9-3-4-17-7-9/h1-2,9,12,15H,3-8H2 |
| InChIKey | XJQFEJWKPBJDEZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |