C12H17F2NO2S — CID 79479183
[1-[[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]methyl]cyclopropyl]methanol (PubChem CID 79479183) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is [1-[[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 79479183 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | [1-[[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]methyl]cyclopropyl]methanol |
| SMILES | OCC1(CNCc2ccc(CSC(F)F)o2)CC1 |
| InChI | InChI=1S/C12H17F2NO2S/c13-11(14)18-6-10-2-1-9(17-10)5-15-7-12(8-16)3-4-12/h1-2,11,15-16H,3-8H2 |
| InChIKey | ABGMTIHKTJEWJN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |