C12H19F2NO2S — CID 62734092
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-4-methoxybutan-2-amine (PubChem CID 62734092) has the molecular formula C12H19F2NO2S and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-4-methoxybutan-2-amine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-4-methoxybutan-2-amine |
|---|---|
| PubChem CID | 62734092 |
| Molecular Formula | C12H19F2NO2S |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-4-methoxybutan-2-amine |
| SMILES | COCCC(C)NCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H19F2NO2S/c1-9(5-6-16-2)15-7-10-3-4-11(17-10)8-18-12(13)14/h3-4,9,12,15H,5-8H2,1-2H3 |
| InChIKey | NKQSSJCBYRQEBB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |