C14H17F2NOS2 — CID 43783043
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-2-amine (PubChem CID 43783043) has the molecular formula C14H17F2NOS2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-2-amine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 43783043 |
| Molecular Formula | C14H17F2NOS2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-2-amine |
| SMILES | CC(Cc1cccs1)NCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C14H17F2NOS2/c1-10(7-13-3-2-6-19-13)17-8-11-4-5-12(18-11)9-20-14(15)16/h2-6,10,14,17H,7-9H2,1H3 |
| InChIKey | XRFFGBGTRINTMH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |