C15H16ClF2NOS — CID 81375041
(1R)-1-(2-chlorophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine (PubChem CID 81375041) has the molecular formula C15H16ClF2NOS and a molecular weight of 331.82 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(2-chlorophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 81375041 |
| Molecular Formula | C15H16ClF2NOS |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(CSC(F)F)o1)c1ccccc1Cl |
| InChI | InChI=1S/C15H16ClF2NOS/c1-10(13-4-2-3-5-14(13)16)19-8-11-6-7-12(20-11)9-21-15(17)18/h2-7,10,15,19H,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | KKCONMYEBBRIST-SNVBAGLBSA-N |
| XLogP | 5.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |