C8H9Br2NO2 — CID 106856150
2-bromo-N-(1-bromopropan-2-yl)furan-3-carboxamide (PubChem CID 106856150) has the molecular formula C8H9Br2NO2 and a molecular weight of 310.97 g/mol. Its IUPAC name is 2-bromo-N-(1-bromopropan-2-yl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(1-bromopropan-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106856150 |
| Molecular Formula | C8H9Br2NO2 |
| Molecular Weight | 310.97 g/mol |
| Exact Mass | 308.90 |
| IUPAC Name | 2-bromo-N-(1-bromopropan-2-yl)furan-3-carboxamide |
| SMILES | CC(CBr)NC(=O)c1ccoc1Br |
| InChI | InChI=1S/C8H9Br2NO2/c1-5(4-9)11-8(12)6-2-3-13-7(6)10/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | GVNJFFLDIXEUDL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.97 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|