C10H12BrNO4 — CID 106851080
(2R)-2-[(2-bromofuran-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 106851080) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is (2R)-2-[(2-bromofuran-3-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-bromofuran-3-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106851080 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (2R)-2-[(2-bromofuran-3-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccoc1Br)C(=O)O |
| InChI | InChI=1S/C10H12BrNO4/c1-5(2)7(10(14)15)12-9(13)6-3-4-16-8(6)11/h3-5,7H,1-2H3,(H,12,13)(H,14,15)/t7-/m1/s1 |
| InChIKey | NPFZEMAWBCYXQO-SSDOTTSWSA-N |
| XLogP | 1.88 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |