C24H27ClN2O2S — CID 41152356
N-[5-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide (PubChem CID 41152356) has the molecular formula C24H27ClN2O2S and a molecular weight of 443.01 g/mol. Its IUPAC name is N-[5-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 41152356 |
| Molecular Formula | C24H27ClN2O2S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[5-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc(Cl)c(NC(=O)c2cccs2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H27ClN2O2S/c1-14(24-11-15-7-16(12-24)9-17(8-15)13-24)26-22(28)18-4-5-19(25)20(10-18)27-23(29)21-3-2-6-30-21/h2-6,10,14-17H,7-9,11-13H2,1H3,(H,26,28)(H,27,29)/t14-,15?,16?,17?,24?/m0/s1 |
| InChIKey | KGRJGMJGHMWSNO-IOAHRDFVSA-N |
| XLogP | 5.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |